C13H18BrNO2 — CID 115222859
2-(5-bromo-2-methoxy-N,3,4,6-tetramethylanilino)acetaldehyde (PubChem CID 115222859) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxy-N,3,4,6-tetramethylanilino)acetaldehyde.
| Compound Name | 2-(5-bromo-2-methoxy-N,3,4,6-tetramethylanilino)acetaldehyde |
|---|---|
| PubChem CID | 115222859 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-(5-bromo-2-methoxy-N,3,4,6-tetramethylanilino)acetaldehyde |
| SMILES | COc1c(C)c(C)c(Br)c(C)c1N(C)CC=O |
| InChI | InChI=1S/C13H18BrNO2/c1-8-9(2)13(17-5)12(10(3)11(8)14)15(4)6-7-16/h7H,6H2,1-5H3 |
| InChIKey | ZXZSBBUWSPQSKO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|