About (5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid
(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid (PubChem CID 115170804) has the molecular formula C12H16BrNO3
and a molecular weight of 302.17 g/mol. Its IUPAC name is (5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid.
Analyze (5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid?
The IUPAC name of (5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid (CID 115170804) is (5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid.
What is the SMILES notation for (5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid?
The canonical SMILES for (5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid is COc1c(C)c(C)c(Br)c(C)c1N(C)C(=O)O.
What is the InChIKey of (5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid?
The InChIKey is VRZYBVACKNTWLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO3/c1-6-7(2)11(17-5)10(8(3)9(6)13)14(4)12(15)16/h1-5H3,(H,15,16).
What are the key properties of (5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid?
(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid has a molecular weight of 302.17 g/mol, XLogP of 3.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2-methoxy-3,4,6-trimethylphenyl)-methylcarbamic acid is sourced from PubChem (CID 115170804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).