C14H17BrO3 — CID 116843289
methyl 2-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)prop-2-enoate (PubChem CID 116843289) has the molecular formula C14H17BrO3 and a molecular weight of 313.19 g/mol. Its IUPAC name is methyl 2-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)prop-2-enoate.
| Compound Name | methyl 2-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 116843289 |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | methyl 2-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC)c1c(C)c(Br)c(C)c(C)c1OC |
| InChI | InChI=1S/C14H17BrO3/c1-7-8(2)13(17-5)11(9(3)12(7)15)10(4)14(16)18-6/h4H2,1-3,5-6H3 |
| InChIKey | SDMVFMCEJWPKEZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|