C11H13BrClNO2 — CID 115194439
N-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)carbamoyl chloride (PubChem CID 115194439) has the molecular formula C11H13BrClNO2 and a molecular weight of 306.59 g/mol. Its IUPAC name is N-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)carbamoyl chloride.
| Compound Name | N-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)carbamoyl chloride |
|---|---|
| PubChem CID | 115194439 |
| Molecular Formula | C11H13BrClNO2 |
| Molecular Weight | 306.59 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | N-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)carbamoyl chloride |
| SMILES | COc1c(C)c(C)c(Br)c(C)c1NC(=O)Cl |
| InChI | InChI=1S/C11H13BrClNO2/c1-5-6(2)10(16-4)9(14-11(13)15)7(3)8(5)12/h1-4H3,(H,14,15) |
| InChIKey | GQSWREIFJMLYGR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|