C15H24BrNO2 — CID 115250590
2-[(5-bromo-2-methoxy-3,4,6-trimethylanilino)methyl]butan-1-ol (PubChem CID 115250590) has the molecular formula C15H24BrNO2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxy-3,4,6-trimethylanilino)methyl]butan-1-ol.
| Compound Name | 2-[(5-bromo-2-methoxy-3,4,6-trimethylanilino)methyl]butan-1-ol |
|---|---|
| PubChem CID | 115250590 |
| Molecular Formula | C15H24BrNO2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[(5-bromo-2-methoxy-3,4,6-trimethylanilino)methyl]butan-1-ol |
| SMILES | CCC(CO)CNc1c(C)c(Br)c(C)c(C)c1OC |
| InChI | InChI=1S/C15H24BrNO2/c1-6-12(8-18)7-17-14-11(4)13(16)9(2)10(3)15(14)19-5/h12,17-18H,6-8H2,1-5H3 |
| InChIKey | FBAPSFXODNEPNU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |