C13H19BrClNO — CID 115215467
5-bromo-N-(3-chloropropyl)-2-methoxy-3,4,6-trimethylaniline (PubChem CID 115215467) has the molecular formula C13H19BrClNO and a molecular weight of 320.66 g/mol. Its IUPAC name is 5-bromo-N-(3-chloropropyl)-2-methoxy-3,4,6-trimethylaniline.
| Compound Name | 5-bromo-N-(3-chloropropyl)-2-methoxy-3,4,6-trimethylaniline |
|---|---|
| PubChem CID | 115215467 |
| Molecular Formula | C13H19BrClNO |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 5-bromo-N-(3-chloropropyl)-2-methoxy-3,4,6-trimethylaniline |
| SMILES | COc1c(C)c(C)c(Br)c(C)c1NCCCCl |
| InChI | InChI=1S/C13H19BrClNO/c1-8-9(2)13(17-4)12(10(3)11(8)14)16-7-5-6-15/h16H,5-7H2,1-4H3 |
| InChIKey | NDUZFTQEIVGNLQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|