C13H19BrClNO — CID 116952703
1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-2-chloro-N-methylethanamine (PubChem CID 116952703) has the molecular formula C13H19BrClNO and a molecular weight of 320.66 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-2-chloro-N-methylethanamine.
| Compound Name | 1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-2-chloro-N-methylethanamine |
|---|---|
| PubChem CID | 116952703 |
| Molecular Formula | C13H19BrClNO |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-2-chloro-N-methylethanamine |
| SMILES | CNC(CCl)c1c(C)c(Br)c(C)c(C)c1OC |
| InChI | InChI=1S/C13H19BrClNO/c1-7-8(2)13(17-5)11(9(3)12(7)14)10(6-15)16-4/h10,16H,6H2,1-5H3 |
| InChIKey | MUZBSKZBRCDMDX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|