C13H21ClN2O — CID 116954431
1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-N,N'-dimethylmethanediamine (PubChem CID 116954431) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-N,N'-dimethylmethanediamine.
| Compound Name | 1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 116954431 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-N,N'-dimethylmethanediamine |
| SMILES | CNC(NC)c1c(C)c(Cl)c(C)c(C)c1OC |
| InChI | InChI=1S/C13H21ClN2O/c1-7-8(2)12(17-6)10(9(3)11(7)14)13(15-4)16-5/h13,15-16H,1-6H3 |
| InChIKey | GGDRCVZIUQDSMJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|