C12H15BrN2O3 — CID 115191621
N'-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)oxamide (PubChem CID 115191621) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is N'-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)oxamide.
| Compound Name | N'-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)oxamide |
|---|---|
| PubChem CID | 115191621 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | N'-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)oxamide |
| SMILES | COc1c(C)c(C)c(Br)c(C)c1NC(=O)C(N)=O |
| InChI | InChI=1S/C12H15BrN2O3/c1-5-6(2)10(18-4)9(7(3)8(5)13)15-12(17)11(14)16/h1-4H3,(H2,14,16)(H,15,17) |
| InChIKey | XOJZGVNDKYXFTO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|