C12H15BrO2S — CID 116829936
1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-2-sulfanylethanone (PubChem CID 116829936) has the molecular formula C12H15BrO2S and a molecular weight of 303.22 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-2-sulfanylethanone.
| Compound Name | 1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-2-sulfanylethanone |
|---|---|
| PubChem CID | 116829936 |
| Molecular Formula | C12H15BrO2S |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-2-sulfanylethanone |
| SMILES | COc1c(C)c(C)c(Br)c(C)c1C(=O)CS |
| InChI | InChI=1S/C12H15BrO2S/c1-6-7(2)12(15-4)10(9(14)5-16)8(3)11(6)13/h16H,5H2,1-4H3 |
| InChIKey | JCEJWLUTZMSYEW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|