C14H19BrO2 — CID 116927740
4-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)butan-2-one (PubChem CID 116927740) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 4-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)butan-2-one.
| Compound Name | 4-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)butan-2-one |
|---|---|
| PubChem CID | 116927740 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)butan-2-one |
| SMILES | COc1c(C)c(C)c(Br)c(C)c1CCC(C)=O |
| InChI | InChI=1S/C14H19BrO2/c1-8(16)6-7-12-11(4)13(15)9(2)10(3)14(12)17-5/h6-7H2,1-5H3 |
| InChIKey | PCQOMPXLNAIONM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |