C15H22O5 — CID 88733446
4-(2,3,4,5-tetramethoxy-6-methylphenyl)butan-2-one (PubChem CID 88733446) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-(2,3,4,5-tetramethoxy-6-methylphenyl)butan-2-one.
| Compound Name | 4-(2,3,4,5-tetramethoxy-6-methylphenyl)butan-2-one |
|---|---|
| PubChem CID | 88733446 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-(2,3,4,5-tetramethoxy-6-methylphenyl)butan-2-one |
| SMILES | COc1c(C)c(CCC(C)=O)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C15H22O5/c1-9(16)7-8-11-10(2)12(17-3)14(19-5)15(20-6)13(11)18-4/h7-8H2,1-6H3 |
| InChIKey | FZGBEXDASLLSJK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |