C19H28O4 — CID 86745749
[(Z)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methylpent-2-enyl] acetate (PubChem CID 86745749) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is [(Z)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methylpent-2-enyl] acetate.
| Compound Name | [(Z)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methylpent-2-enyl] acetate |
|---|---|
| PubChem CID | 86745749 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | [(Z)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methylpent-2-enyl] acetate |
| SMILES | COc1c(C)c(C)c(OC)c(CC/C(C)=C\COC(C)=O)c1C |
| InChI | InChI=1S/C19H28O4/c1-12(10-11-23-16(5)20)8-9-17-15(4)18(21-6)13(2)14(3)19(17)22-7/h10H,8-9,11H2,1-7H3/b12-10- |
| InChIKey | SGSTVZCDIYXEST-BENRWUELSA-N |
| XLogP | 4.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|