C18H26O6 — CID 101259572
[(E)-5-(2-hydroxy-3,6-dimethoxy-4,5-dimethylphenyl)-3-methylpent-2-enyl] methyl carbonate (PubChem CID 101259572) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is [(E)-5-(2-hydroxy-3,6-dimethoxy-4,5-dimethylphenyl)-3-methylpent-2-enyl] methyl carbonate.
| Compound Name | [(E)-5-(2-hydroxy-3,6-dimethoxy-4,5-dimethylphenyl)-3-methylpent-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 101259572 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | [(E)-5-(2-hydroxy-3,6-dimethoxy-4,5-dimethylphenyl)-3-methylpent-2-enyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C(\C)CCc1c(O)c(OC)c(C)c(C)c1OC |
| InChI | InChI=1S/C18H26O6/c1-11(9-10-24-18(20)23-6)7-8-14-15(19)17(22-5)13(3)12(2)16(14)21-4/h9,19H,7-8,10H2,1-6H3/b11-9+ |
| InChIKey | ONWWIWOEFNCIAE-PKNBQFBNSA-N |
| XLogP | 3.69 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|