C14H20O4 — CID 22943714
3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propanoic acid (PubChem CID 22943714) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propanoic acid.
| Compound Name | 3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 22943714 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-(2,5-dimethoxy-3,4,6-trimethylphenyl)propanoic acid |
| SMILES | COc1c(C)c(C)c(OC)c(CCC(=O)O)c1C |
| InChI | InChI=1S/C14H20O4/c1-8-9(2)14(18-5)11(6-7-12(15)16)10(3)13(8)17-4/h6-7H2,1-5H3,(H,15,16) |
| InChIKey | QTYDODUDQARIQX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |