C12H19NO2 — CID 139777100
(2,5-dimethoxy-3,4,6-trimethylphenyl)methanamine (PubChem CID 139777100) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (2,5-dimethoxy-3,4,6-trimethylphenyl)methanamine.
| Compound Name | (2,5-dimethoxy-3,4,6-trimethylphenyl)methanamine |
|---|---|
| PubChem CID | 139777100 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (2,5-dimethoxy-3,4,6-trimethylphenyl)methanamine |
| SMILES | COc1c(C)c(C)c(OC)c(CN)c1C |
| InChI | InChI=1S/C12H19NO2/c1-7-8(2)12(15-5)10(6-13)9(3)11(7)14-4/h6,13H2,1-5H3 |
| InChIKey | FNYCGHPWRAPTBH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |