C17H26O3 — CID 134990490
4-(2,5-dimethoxy-3,4,6-trimethylphenyl)-2,2-dimethylbutanal (PubChem CID 134990490) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 4-(2,5-dimethoxy-3,4,6-trimethylphenyl)-2,2-dimethylbutanal.
| Compound Name | 4-(2,5-dimethoxy-3,4,6-trimethylphenyl)-2,2-dimethylbutanal |
|---|---|
| PubChem CID | 134990490 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 4-(2,5-dimethoxy-3,4,6-trimethylphenyl)-2,2-dimethylbutanal |
| SMILES | COc1c(C)c(C)c(OC)c(CCC(C)(C)C=O)c1C |
| InChI | InChI=1S/C17H26O3/c1-11-12(2)16(20-7)14(13(3)15(11)19-6)8-9-17(4,5)10-18/h10H,8-9H2,1-7H3 |
| InChIKey | MUXKEEVOVYQZDT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|