C31H55ClO2 — CID 58972231
1-(3-chloro-3,7,11,15-tetramethylhexadecyl)-2,5-dimethoxy-3,4,6-trimethylbenzene (PubChem CID 58972231) has the molecular formula C31H55ClO2 and a molecular weight of 495.23 g/mol. Its IUPAC name is 1-(3-chloro-3,7,11,15-tetramethylhexadecyl)-2,5-dimethoxy-3,4,6-trimethylbenzene.
| Compound Name | 1-(3-chloro-3,7,11,15-tetramethylhexadecyl)-2,5-dimethoxy-3,4,6-trimethylbenzene |
|---|---|
| PubChem CID | 58972231 |
| Molecular Formula | C31H55ClO2 |
| Molecular Weight | 495.23 g/mol |
| Exact Mass | 494.39 |
| IUPAC Name | 1-(3-chloro-3,7,11,15-tetramethylhexadecyl)-2,5-dimethoxy-3,4,6-trimethylbenzene |
| SMILES | COc1c(C)c(C)c(OC)c(CCC(C)(Cl)CCCC(C)CCCC(C)CCCC(C)C)c1C |
| InChI | InChI=1S/C31H55ClO2/c1-22(2)14-11-15-23(3)16-12-17-24(4)18-13-20-31(8,32)21-19-28-27(7)29(33-9)25(5)26(6)30(28)34-10/h22-24H,11-21H2,1-10H3 |
| InChIKey | XMTSRHNFHPALET-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.23 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|