C29H52O4 — CID 42626984
2,3-dimethoxy-5-methyl-6-(3,7,11,15-tetramethylhexadecyl)benzene-1,4-diol (PubChem CID 42626984) has the molecular formula C29H52O4 and a molecular weight of 464.73 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-(3,7,11,15-tetramethylhexadecyl)benzene-1,4-diol.
| Compound Name | 2,3-dimethoxy-5-methyl-6-(3,7,11,15-tetramethylhexadecyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 42626984 |
| Molecular Formula | C29H52O4 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.39 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-(3,7,11,15-tetramethylhexadecyl)benzene-1,4-diol |
| SMILES | COc1c(O)c(C)c(CCC(C)CCCC(C)CCCC(C)CCCC(C)C)c(O)c1OC |
| InChI | InChI=1S/C29H52O4/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-17-23(5)18-19-25-24(6)26(30)28(32-7)29(33-8)27(25)31/h20-23,30-31H,9-19H2,1-8H3 |
| InChIKey | DKZJFXUWFFQHGG-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|