C31H52O2 — CID 123504445
2,3,5-trimethyl-6-[(3R,7S,11R)-3,7,11,15-tetramethylhexadecyl]terephthalaldehyde (PubChem CID 123504445) has the molecular formula C31H52O2 and a molecular weight of 456.76 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-[(3R,7S,11R)-3,7,11,15-tetramethylhexadecyl]terephthalaldehyde.
| Compound Name | 2,3,5-trimethyl-6-[(3R,7S,11R)-3,7,11,15-tetramethylhexadecyl]terephthalaldehyde |
|---|---|
| PubChem CID | 123504445 |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | 2,3,5-trimethyl-6-[(3R,7S,11R)-3,7,11,15-tetramethylhexadecyl]terephthalaldehyde |
| SMILES | Cc1c(C)c(C=O)c(CC[C@H](C)CCC[C@@H](C)CCC[C@H](C)CCCC(C)C)c(C)c1C=O |
| InChI | InChI=1S/C31H52O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)18-19-29-28(8)30(20-32)26(6)27(7)31(29)21-33/h20-25H,9-19H2,1-8H3/t23-,24+,25-/m1/s1 |
| InChIKey | AQHPPUQBMDKQIP-DSNGMDLFSA-N |
| XLogP | 9.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|