C14H27N5 — CID 23524567
5-(3,7-dimethyloctyl)pyrimidine-2,4,6-triamine (PubChem CID 23524567) has the molecular formula C14H27N5 and a molecular weight of 265.40 g/mol. Its IUPAC name is 5-(3,7-dimethyloctyl)pyrimidine-2,4,6-triamine.
| Compound Name | 5-(3,7-dimethyloctyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 23524567 |
| Molecular Formula | C14H27N5 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.23 |
| IUPAC Name | 5-(3,7-dimethyloctyl)pyrimidine-2,4,6-triamine |
| SMILES | CC(C)CCCC(C)CCc1c(N)nc(N)nc1N |
| InChI | InChI=1S/C14H27N5/c1-9(2)5-4-6-10(3)7-8-11-12(15)18-14(17)19-13(11)16/h9-10H,4-8H2,1-3H3,(H6,15,16,17,18,19) |
| InChIKey | WTXFKZIAXNZMQV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |