C19H34O14S2 — CID 88674075
10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)decanoic acid;sulfuric acid (PubChem CID 88674075) has the molecular formula C19H34O14S2 and a molecular weight of 550.60 g/mol. Its IUPAC name is 10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)decanoic acid;sulfuric acid.
| Compound Name | 10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)decanoic acid;sulfuric acid |
|---|---|
| PubChem CID | 88674075 |
| Molecular Formula | C19H34O14S2 |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 10-(2,5-dihydroxy-3,4-dimethoxy-6-methylphenyl)decanoic acid;sulfuric acid |
| SMILES | COc1c(O)c(C)c(CCCCCCCCCC(=O)O)c(O)c1OC.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C19H30O6.2H2O4S/c1-13-14(17(23)19(25-3)18(24-2)16(13)22)11-9-7-5-4-6-8-10-12-15(20)21;2*1-5(2,3)4/h22-23H,4-12H2,1-3H3,(H,20,21);2*(H2,1,2,3,4) |
| InChIKey | VPPQMBYHOALJDG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 245.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|