C26H31O4P — CID 172789908
2-(5-diphenylphosphanylpentyl)-5,6-dimethoxy-3-methylbenzene-1,4-diol (PubChem CID 172789908) has the molecular formula C26H31O4P and a molecular weight of 438.50 g/mol. Its IUPAC name is 2-(5-diphenylphosphanylpentyl)-5,6-dimethoxy-3-methylbenzene-1,4-diol.
| Compound Name | 2-(5-diphenylphosphanylpentyl)-5,6-dimethoxy-3-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 172789908 |
| Molecular Formula | C26H31O4P |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 2-(5-diphenylphosphanylpentyl)-5,6-dimethoxy-3-methylbenzene-1,4-diol |
| SMILES | COc1c(O)c(C)c(CCCCCP(c2ccccc2)c2ccccc2)c(O)c1OC |
| InChI | InChI=1S/C26H31O4P/c1-19-22(24(28)26(30-3)25(29-2)23(19)27)17-11-6-12-18-31(20-13-7-4-8-14-20)21-15-9-5-10-16-21/h4-5,7-10,13-16,27-28H,6,11-12,17-18H2,1-3H3 |
| InChIKey | PKMLKEDEHVUUHP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|