C38H45BrO5P+ — CID 156792816
[4-[10-(2-bromo-5-hydroxy-3,4-dimethoxy-6-methylphenyl)decyl]phenyl]-formyloxy-diphenylphosphanium (PubChem CID 156792816) has the molecular formula C38H45BrO5P+ and a molecular weight of 692.65 g/mol. Its IUPAC name is [4-[10-(2-bromo-5-hydroxy-3,4-dimethoxy-6-methylphenyl)decyl]phenyl]-formyloxy-diphenylphosphanium.
| Compound Name | [4-[10-(2-bromo-5-hydroxy-3,4-dimethoxy-6-methylphenyl)decyl]phenyl]-formyloxy-diphenylphosphanium |
|---|---|
| PubChem CID | 156792816 |
| Molecular Formula | C38H45BrO5P+ |
| Molecular Weight | 692.65 g/mol |
| Exact Mass | 691.22 |
| IUPAC Name | [4-[10-(2-bromo-5-hydroxy-3,4-dimethoxy-6-methylphenyl)decyl]phenyl]-formyloxy-diphenylphosphanium |
| SMILES | COc1c(O)c(C)c(CCCCCCCCCCc2ccc([P+](OC=O)(c3ccccc3)c3ccccc3)cc2)c(Br)c1OC |
| InChI | InChI=1S/C38H44BrO5P/c1-29-34(35(39)37(42-2)38(43-3)36(29)41)23-17-9-7-5-4-6-8-12-18-30-24-26-33(27-25-30)45(44-28-40,31-19-13-10-14-20-31)32-21-15-11-16-22-32/h10-11,13-16,19-22,24-28H,4-9,12,17-18,23H2,1-3H3/p+1 |
| InChIKey | MPMLORINHINIEE-UHFFFAOYSA-O |
| XLogP | 8.77 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.65 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|