C14H13BrO3 — CID 10380614
2-(3-bromo-1,4-dimethoxynaphthalen-2-yl)acetaldehyde (PubChem CID 10380614) has the molecular formula C14H13BrO3 and a molecular weight of 309.16 g/mol. Its IUPAC name is 2-(3-bromo-1,4-dimethoxynaphthalen-2-yl)acetaldehyde.
| Compound Name | 2-(3-bromo-1,4-dimethoxynaphthalen-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 10380614 |
| Molecular Formula | C14H13BrO3 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 2-(3-bromo-1,4-dimethoxynaphthalen-2-yl)acetaldehyde |
| SMILES | COc1c(Br)c(CC=O)c(OC)c2ccccc12 |
| InChI | InChI=1S/C14H13BrO3/c1-17-13-9-5-3-4-6-10(9)14(18-2)12(15)11(13)7-8-16/h3-6,8H,7H2,1-2H3 |
| InChIKey | WCMLIWWASXNPFY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|