C10H11BrO3 — CID 59259548
2-(3-bromo-4,5-dimethoxyphenyl)acetaldehyde (PubChem CID 59259548) has the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. Its IUPAC name is 2-(3-bromo-4,5-dimethoxyphenyl)acetaldehyde.
| Compound Name | 2-(3-bromo-4,5-dimethoxyphenyl)acetaldehyde |
|---|---|
| PubChem CID | 59259548 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 2-(3-bromo-4,5-dimethoxyphenyl)acetaldehyde |
| SMILES | COc1cc(CC=O)cc(Br)c1OC |
| InChI | InChI=1S/C10H11BrO3/c1-13-9-6-7(3-4-12)5-8(11)10(9)14-2/h4-6H,3H2,1-2H3 |
| InChIKey | MWKSNOHPAOFONP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|