C9H12BrNO4S — CID 165443466
(3-bromo-4,5-dimethoxyphenyl)methanesulfonamide (PubChem CID 165443466) has the molecular formula C9H12BrNO4S and a molecular weight of 310.17 g/mol. Its IUPAC name is (3-bromo-4,5-dimethoxyphenyl)methanesulfonamide.
| Compound Name | (3-bromo-4,5-dimethoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 165443466 |
| Molecular Formula | C9H12BrNO4S |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | (3-bromo-4,5-dimethoxyphenyl)methanesulfonamide |
| SMILES | COc1cc(CS(N)(=O)=O)cc(Br)c1OC |
| InChI | InChI=1S/C9H12BrNO4S/c1-14-8-4-6(5-16(11,12)13)3-7(10)9(8)15-2/h3-4H,5H2,1-2H3,(H2,11,12,13) |
| InChIKey | VJWKOHJXSNSCGA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |