C10H13BrO4S — CID 47471698
1-bromo-2,3-dimethoxy-5-(methylsulfonylmethyl)benzene (PubChem CID 47471698) has the molecular formula C10H13BrO4S and a molecular weight of 309.18 g/mol. Its IUPAC name is 1-bromo-2,3-dimethoxy-5-(methylsulfonylmethyl)benzene.
| Compound Name | 1-bromo-2,3-dimethoxy-5-(methylsulfonylmethyl)benzene |
|---|---|
| PubChem CID | 47471698 |
| Molecular Formula | C10H13BrO4S |
| Molecular Weight | 309.18 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | 1-bromo-2,3-dimethoxy-5-(methylsulfonylmethyl)benzene |
| SMILES | COc1cc(CS(C)(=O)=O)cc(Br)c1OC |
| InChI | InChI=1S/C10H13BrO4S/c1-14-9-5-7(6-16(3,12)13)4-8(11)10(9)15-2/h4-5H,6H2,1-3H3 |
| InChIKey | HZSNZGBCJPWKGY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |