C17H19BrO4 — CID 172870436
5-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-2-methoxyphenol (PubChem CID 172870436) has the molecular formula C17H19BrO4 and a molecular weight of 367.24 g/mol. Its IUPAC name is 5-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-2-methoxyphenol.
| Compound Name | 5-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 172870436 |
| Molecular Formula | C17H19BrO4 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 5-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-2-methoxyphenol |
| SMILES | COc1ccc(CCc2cc(Br)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C17H19BrO4/c1-20-15-7-6-11(9-14(15)19)4-5-12-8-13(18)17(22-3)16(10-12)21-2/h6-10,19H,4-5H2,1-3H3 |
| InChIKey | BWKSJZGVLIGJJH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |