3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid

C18H19BrO4 — CID 159532616

IUPAC3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid
SMILESCOc1cc(CCc2cc(C(=O)O)ccc2C)cc(Br)c1OC
InChIInChI=1S/C18H19BrO4/c1-11-4-6-14(18(20)21)10-13(11)7-5-12-8-15(19)17(23-3)16(9-12)22-2/h4,6,8-10H,5,7H2,1-3H3,(H,20,21)
InChIKeyMKXJLZRBBCDLHG-UHFFFAOYSA-N
MW379.25 g/mol
LogP4.26
Rot. Bonds6

About 3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid

3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid (PubChem CID 159532616) has the molecular formula C18H19BrO4 and a molecular weight of 379.25 g/mol. Its IUPAC name is 3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid.

Molecular Properties

Compound Name3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid
PubChem CID159532616
Molecular FormulaC18H19BrO4
Molecular Weight379.25 g/mol
Exact Mass378.05
IUPAC Name3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid
SMILESCOc1cc(CCc2cc(C(=O)O)ccc2C)cc(Br)c1OC
InChIInChI=1S/C18H19BrO4/c1-11-4-6-14(18(20)21)10-13(11)7-5-12-8-15(19)17(23-3)16(9-12)22-2/h4,6,8-10H,5,7H2,1-3H3,(H,20,21)
InChIKeyMKXJLZRBBCDLHG-UHFFFAOYSA-N
XLogP4.26
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500379.25
LogP ≤ 54.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid?
The IUPAC name of 3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid (CID 159532616) is 3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid.
What is the SMILES notation for 3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid?
The canonical SMILES for 3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid is COc1cc(CCc2cc(C(=O)O)ccc2C)cc(Br)c1OC.
What is the InChIKey of 3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid?
The InChIKey is MKXJLZRBBCDLHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrO4/c1-11-4-6-14(18(20)21)10-13(11)7-5-12-8-15(19)17(23-3)16(9-12)22-2/h4,6,8-10H,5,7H2,1-3H3,(H,20,21).
What are the key properties of 3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid?
3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid has a molecular weight of 379.25 g/mol, XLogP of 4.26, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-4-methylbenzoic acid is sourced from PubChem (CID 159532616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).