C21H24BrNO5 — CID 161349189
5-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-2-morpholin-4-ylbenzoic acid (PubChem CID 161349189) has the molecular formula C21H24BrNO5 and a molecular weight of 450.33 g/mol. Its IUPAC name is 5-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-2-morpholin-4-ylbenzoic acid.
| Compound Name | 5-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-2-morpholin-4-ylbenzoic acid |
|---|---|
| PubChem CID | 161349189 |
| Molecular Formula | C21H24BrNO5 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 5-[2-(3-bromo-4,5-dimethoxyphenyl)ethyl]-2-morpholin-4-ylbenzoic acid |
| SMILES | COc1cc(CCc2ccc(N3CCOCC3)c(C(=O)O)c2)cc(Br)c1OC |
| InChI | InChI=1S/C21H24BrNO5/c1-26-19-13-15(12-17(22)20(19)27-2)4-3-14-5-6-18(16(11-14)21(24)25)23-7-9-28-10-8-23/h5-6,11-13H,3-4,7-10H2,1-2H3,(H,24,25) |
| InChIKey | PVANSTIWIFCLFE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |