C18H19BrN2O5 — CID 17059393
4-[[4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methylamino]-3-methylbenzoic acid (PubChem CID 17059393) has the molecular formula C18H19BrN2O5 and a molecular weight of 423.26 g/mol. Its IUPAC name is 4-[[4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methylamino]-3-methylbenzoic acid.
| Compound Name | 4-[[4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methylamino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 17059393 |
| Molecular Formula | C18H19BrN2O5 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 4-[[4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methylamino]-3-methylbenzoic acid |
| SMILES | COc1cc(CNc2ccc(C(=O)O)cc2C)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C18H19BrN2O5/c1-10-5-12(18(23)24)3-4-14(10)21-8-11-6-13(19)17(15(7-11)25-2)26-9-16(20)22/h3-7,21H,8-9H2,1-2H3,(H2,20,22)(H,23,24) |
| InChIKey | GLMZPJBQPFIBJT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |