C17H17BrN2O5 — CID 17058751
3-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylamino]-4-methoxybenzoic acid (PubChem CID 17058751) has the molecular formula C17H17BrN2O5 and a molecular weight of 409.24 g/mol. Its IUPAC name is 3-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylamino]-4-methoxybenzoic acid.
| Compound Name | 3-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylamino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 17058751 |
| Molecular Formula | C17H17BrN2O5 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 3-[[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylamino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NCc1cc(Br)ccc1OCC(N)=O |
| InChI | InChI=1S/C17H17BrN2O5/c1-24-15-4-2-10(17(22)23)7-13(15)20-8-11-6-12(18)3-5-14(11)25-9-16(19)21/h2-7,20H,8-9H2,1H3,(H2,19,21)(H,22,23) |
| InChIKey | CVEPUEYCKIYRHL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |