C16H15Br2NO4 — CID 17059836
3-[(3,5-dibromo-2-methoxyphenyl)methylamino]-4-methoxybenzoic acid (PubChem CID 17059836) has the molecular formula C16H15Br2NO4 and a molecular weight of 445.11 g/mol. Its IUPAC name is 3-[(3,5-dibromo-2-methoxyphenyl)methylamino]-4-methoxybenzoic acid.
| Compound Name | 3-[(3,5-dibromo-2-methoxyphenyl)methylamino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 17059836 |
| Molecular Formula | C16H15Br2NO4 |
| Molecular Weight | 445.11 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | 3-[(3,5-dibromo-2-methoxyphenyl)methylamino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NCc1cc(Br)cc(Br)c1OC |
| InChI | InChI=1S/C16H15Br2NO4/c1-22-14-4-3-9(16(20)21)6-13(14)19-8-10-5-11(17)7-12(18)15(10)23-2/h3-7,19H,8H2,1-2H3,(H,20,21) |
| InChIKey | ZDXWDQXHAMHKKH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.11 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |