C17H19BrO3 — CID 101439274
(2S)-1-(3-bromo-1,4-dimethoxynaphthalen-2-yl)pent-4-en-2-ol (PubChem CID 101439274) has the molecular formula C17H19BrO3 and a molecular weight of 351.24 g/mol. Its IUPAC name is (2S)-1-(3-bromo-1,4-dimethoxynaphthalen-2-yl)pent-4-en-2-ol.
| Compound Name | (2S)-1-(3-bromo-1,4-dimethoxynaphthalen-2-yl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 101439274 |
| Molecular Formula | C17H19BrO3 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (2S)-1-(3-bromo-1,4-dimethoxynaphthalen-2-yl)pent-4-en-2-ol |
| SMILES | C=CC[C@H](O)Cc1c(Br)c(OC)c2ccccc2c1OC |
| InChI | InChI=1S/C17H19BrO3/c1-4-7-11(19)10-14-15(18)17(21-3)13-9-6-5-8-12(13)16(14)20-2/h4-6,8-9,11,19H,1,7,10H2,2-3H3/t11-/m0/s1 |
| InChIKey | ZITNNLRQPDSPRG-NSHDSACASA-N |
| XLogP | 4.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|