C18H19BrO5 — CID 68765801
2-methoxyethyl 3-(3-bromo-1,4-dimethoxynaphthalen-2-yl)prop-2-enoate (PubChem CID 68765801) has the molecular formula C18H19BrO5 and a molecular weight of 395.25 g/mol. Its IUPAC name is 2-methoxyethyl 3-(3-bromo-1,4-dimethoxynaphthalen-2-yl)prop-2-enoate.
| Compound Name | 2-methoxyethyl 3-(3-bromo-1,4-dimethoxynaphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 68765801 |
| Molecular Formula | C18H19BrO5 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-methoxyethyl 3-(3-bromo-1,4-dimethoxynaphthalen-2-yl)prop-2-enoate |
| SMILES | COCCOC(=O)C=Cc1c(Br)c(OC)c2ccccc2c1OC |
| InChI | InChI=1S/C18H19BrO5/c1-21-10-11-24-15(20)9-8-14-16(19)18(23-3)13-7-5-4-6-12(13)17(14)22-2/h4-9H,10-11H2,1-3H3 |
| InChIKey | QFJAPLGTIGARAO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|