About 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate
2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate (PubChem CID 169432205) has the molecular formula C18H23NO3Si
and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate |
| PubChem CID | 169432205 |
| Molecular Formula | C18H23NO3Si |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate |
| SMILES | COc1ccc2ncccc2c1/C=C/C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C18H23NO3Si/c1-21-17-9-8-16-14(6-5-11-19-16)15(17)7-10-18(20)22-12-13-23(2,3)4/h5-11H,12-13H2,1-4H3/b10-7+ |
| InChIKey | QPPMVTODOZTPGE-JXMROGBWSA-N |
| XLogP | 4.14 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate?
The IUPAC name of 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate (CID 169432205) is 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate.
What is the SMILES notation for 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate?
The canonical SMILES for 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate is COc1ccc2ncccc2c1/C=C/C(=O)OCC[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate?
The InChIKey is QPPMVTODOZTPGE-JXMROGBWSA-N. The full InChI is InChI=1S/C18H23NO3Si/c1-21-17-9-8-16-14(6-5-11-19-16)15(17)7-10-18(20)22-12-13-23(2,3)4/h5-11H,12-13H2,1-4H3/b10-7+.
What are the key properties of 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate?
2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate has a molecular weight of 329.47 g/mol, XLogP of 4.14, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl (E)-3-(6-methoxyquinolin-5-yl)prop-2-enoate is sourced from PubChem (CID 169432205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).