C20H21ClO6 — CID 6271589
2-(2-chlorophenoxy)ethyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 6271589) has the molecular formula C20H21ClO6 and a molecular weight of 392.84 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | 2-(2-chlorophenoxy)ethyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6271589 |
| Molecular Formula | C20H21ClO6 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCCOc2ccccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C20H21ClO6/c1-23-17-12-14(13-18(24-2)20(17)25-3)8-9-19(22)27-11-10-26-16-7-5-4-6-15(16)21/h4-9,12-13H,10-11H2,1-3H3/b9-8+ |
| InChIKey | DNSPXAIYCXGBLH-CMDGGOBGSA-N |
| XLogP | 4.00 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|