C31H54O3 — CID 146501240
(E,1R,7R,11R)-1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3,7,11,15-tetramethylhexadec-2-en-1-ol (PubChem CID 146501240) has the molecular formula C31H54O3 and a molecular weight of 474.77 g/mol. Its IUPAC name is (E,1R,7R,11R)-1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3,7,11,15-tetramethylhexadec-2-en-1-ol.
| Compound Name | (E,1R,7R,11R)-1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3,7,11,15-tetramethylhexadec-2-en-1-ol |
|---|---|
| PubChem CID | 146501240 |
| Molecular Formula | C31H54O3 |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.41 |
| IUPAC Name | (E,1R,7R,11R)-1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3,7,11,15-tetramethylhexadec-2-en-1-ol |
| SMILES | COc1c(C)c(C)c(OC)c([C@H](O)/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)c1C |
| InChI | InChI=1S/C31H54O3/c1-21(2)14-11-15-22(3)16-12-17-23(4)18-13-19-24(5)20-28(32)29-27(8)30(33-9)25(6)26(7)31(29)34-10/h20-23,28,32H,11-19H2,1-10H3/b24-20+/t22-,23-,28-/m1/s1 |
| InChIKey | QCYDLEWGWAXFKN-BMUMOGJKSA-N |
| XLogP | 9.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|