3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid

C13H17FO4 — CID 117393987

IUPAC3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid
SMILESCOc1c(C)c(CCC(=O)O)c(OC)c(C)c1F
InChIInChI=1S/C13H17FO4/c1-7-9(5-6-10(15)16)12(17-3)8(2)11(14)13(7)18-4/h5-6H2,1-4H3,(H,15,16)
InChIKeyFHMNJOUINWPAEA-UHFFFAOYSA-N
MW256.27 g/mol
LogP2.48
Rot. Bonds5

About 3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid

3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid (PubChem CID 117393987) has the molecular formula C13H17FO4 and a molecular weight of 256.27 g/mol. Its IUPAC name is 3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid.

Molecular Properties

Compound Name3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid
PubChem CID117393987
Molecular FormulaC13H17FO4
Molecular Weight256.27 g/mol
Exact Mass256.11
IUPAC Name3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid
SMILESCOc1c(C)c(CCC(=O)O)c(OC)c(C)c1F
InChIInChI=1S/C13H17FO4/c1-7-9(5-6-10(15)16)12(17-3)8(2)11(14)13(7)18-4/h5-6H2,1-4H3,(H,15,16)
InChIKeyFHMNJOUINWPAEA-UHFFFAOYSA-N
XLogP2.48
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.27
LogP ≤ 52.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid?
The IUPAC name of 3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid (CID 117393987) is 3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid.
What is the SMILES notation for 3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid?
The canonical SMILES for 3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid is COc1c(C)c(CCC(=O)O)c(OC)c(C)c1F.
What is the InChIKey of 3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid?
The InChIKey is FHMNJOUINWPAEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FO4/c1-7-9(5-6-10(15)16)12(17-3)8(2)11(14)13(7)18-4/h5-6H2,1-4H3,(H,15,16).
What are the key properties of 3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid?
3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid has a molecular weight of 256.27 g/mol, XLogP of 2.48, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluoro-2,5-dimethoxy-3,6-dimethylphenyl)propanoic acid is sourced from PubChem (CID 117393987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).