About N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide
N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide (PubChem CID 115171933) has the molecular formula C12H13ClN2O2
and a molecular weight of 252.70 g/mol. Its IUPAC name is N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide.
Molecular Properties
| Compound Name | N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide |
| PubChem CID | 115171933 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide |
| SMILES | COc1c(C)c(C)c(Cl)c(C)c1NC(=O)C#N |
| InChI | InChI=1S/C12H13ClN2O2/c1-6-7(2)12(17-4)11(8(3)10(6)13)15-9(16)5-14/h1-4H3,(H,15,16) |
| InChIKey | DLHPZAKTBAARFD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|
Analyze N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide?
The IUPAC name of N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide (CID 115171933) is N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide.
What is the SMILES notation for N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide?
The canonical SMILES for N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide is COc1c(C)c(C)c(Cl)c(C)c1NC(=O)C#N.
What is the InChIKey of N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide?
The InChIKey is DLHPZAKTBAARFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O2/c1-6-7(2)12(17-4)11(8(3)10(6)13)15-9(16)5-14/h1-4H3,(H,15,16).
What are the key properties of N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide?
N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide has a molecular weight of 252.70 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide is sourced from PubChem (CID 115171933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).