C12H13ClN2O2 — CID 115171933
N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide (PubChem CID 115171933) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide.
| Compound Name | N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide |
|---|---|
| PubChem CID | 115171933 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-1-cyanoformamide |
| SMILES | COc1c(C)c(C)c(Cl)c(C)c1NC(=O)C#N |
| InChI | InChI=1S/C12H13ClN2O2/c1-6-7(2)12(17-4)11(8(3)10(6)13)15-9(16)5-14/h1-4H3,(H,15,16) |
| InChIKey | DLHPZAKTBAARFD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|