C11H15NO3 — CID 88634868
4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde (PubChem CID 88634868) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde.
| Compound Name | 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 88634868 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde |
| SMILES | COc1c(C)c(C=O)c(C)c(OC)c1N |
| InChI | InChI=1S/C11H15NO3/c1-6-8(5-13)7(2)11(15-4)9(12)10(6)14-3/h5H,12H2,1-4H3 |
| InChIKey | PNORZMGRIIOGFU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|