About 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde
4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde (PubChem CID 88634868) has the molecular formula C11H15NO3
and a molecular weight of 209.24 g/mol. Its IUPAC name is 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde |
| PubChem CID | 88634868 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde |
| SMILES | COc1c(C)c(C=O)c(C)c(OC)c1N |
| InChI | InChI=1S/C11H15NO3/c1-6-8(5-13)7(2)11(15-4)9(12)10(6)14-3/h5H,12H2,1-4H3 |
| InChIKey | PNORZMGRIIOGFU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde?
The IUPAC name of 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde (CID 88634868) is 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde.
What is the SMILES notation for 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde?
The canonical SMILES for 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde is COc1c(C)c(C=O)c(C)c(OC)c1N.
What is the InChIKey of 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde?
The InChIKey is PNORZMGRIIOGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-6-8(5-13)7(2)11(15-4)9(12)10(6)14-3/h5H,12H2,1-4H3.
What are the key properties of 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde?
4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde has a molecular weight of 209.24 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5-dimethoxy-2,6-dimethylbenzaldehyde is sourced from PubChem (CID 88634868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).