C11H13BrO4 — CID 117466700
6-bromo-4-(2-hydroxyethyl)-2,3-dimethoxybenzaldehyde (PubChem CID 117466700) has the molecular formula C11H13BrO4 and a molecular weight of 289.12 g/mol. Its IUPAC name is 6-bromo-4-(2-hydroxyethyl)-2,3-dimethoxybenzaldehyde.
| Compound Name | 6-bromo-4-(2-hydroxyethyl)-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 117466700 |
| Molecular Formula | C11H13BrO4 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 6-bromo-4-(2-hydroxyethyl)-2,3-dimethoxybenzaldehyde |
| SMILES | COc1c(CCO)cc(Br)c(C=O)c1OC |
| InChI | InChI=1S/C11H13BrO4/c1-15-10-7(3-4-13)5-9(12)8(6-14)11(10)16-2/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | UOBQYJPFUMBCJL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|