C11H14O2 — CID 131744702
2-(2-hydroxyethyl)-4,6-dimethylbenzaldehyde (PubChem CID 131744702) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-4,6-dimethylbenzaldehyde.
| Compound Name | 2-(2-hydroxyethyl)-4,6-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 131744702 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-(2-hydroxyethyl)-4,6-dimethylbenzaldehyde |
| SMILES | Cc1cc(C)c(C=O)c(CCO)c1 |
| InChI | InChI=1S/C11H14O2/c1-8-5-9(2)11(7-13)10(6-8)3-4-12/h5-7,12H,3-4H2,1-2H3 |
| InChIKey | ILZLINAKHRLZSK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|