C9H11NO — CID 114553787
2-amino-4,6-dimethylbenzaldehyde (PubChem CID 114553787) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-amino-4,6-dimethylbenzaldehyde.
| Compound Name | 2-amino-4,6-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 114553787 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-amino-4,6-dimethylbenzaldehyde |
| SMILES | Cc1cc(C)c(C=O)c(N)c1 |
| InChI | InChI=1S/C9H11NO/c1-6-3-7(2)8(5-11)9(10)4-6/h3-5H,10H2,1-2H3 |
| InChIKey | HHEJOVBESNBJKW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|