About 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine
7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine (PubChem CID 149181208) has the molecular formula C6H4BrN3OS
and a molecular weight of 246.09 g/mol. Its IUPAC name is 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine.
Molecular Properties
| Compound Name | 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine |
| PubChem CID | 149181208 |
| Molecular Formula | C6H4BrN3OS |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 244.93 |
| IUPAC Name | 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine |
| SMILES | COc1ncc(Br)c2nsnc12 |
| InChI | InChI=1S/C6H4BrN3OS/c1-11-6-5-4(9-12-10-5)3(7)2-8-6/h2H,1H3 |
| InChIKey | XAZOAYIMMQVGIY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine?
The IUPAC name of 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine (CID 149181208) is 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine.
What is the SMILES notation for 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine?
The canonical SMILES for 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine is COc1ncc(Br)c2nsnc12.
What is the InChIKey of 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine?
The InChIKey is XAZOAYIMMQVGIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3OS/c1-11-6-5-4(9-12-10-5)3(7)2-8-6/h2H,1H3.
What are the key properties of 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine?
7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine has a molecular weight of 246.09 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-methoxy-[1,2,5]thiadiazolo[3,4-c]pyridine is sourced from PubChem (CID 149181208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).