C24H37BrN2O2S — CID 123143923
4-bromo-7-methyl-6-non-1-en-2-yloxy-5-octoxy-2,1,3-benzothiadiazole (PubChem CID 123143923) has the molecular formula C24H37BrN2O2S and a molecular weight of 497.54 g/mol. Its IUPAC name is 4-bromo-7-methyl-6-non-1-en-2-yloxy-5-octoxy-2,1,3-benzothiadiazole.
| Compound Name | 4-bromo-7-methyl-6-non-1-en-2-yloxy-5-octoxy-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 123143923 |
| Molecular Formula | C24H37BrN2O2S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 4-bromo-7-methyl-6-non-1-en-2-yloxy-5-octoxy-2,1,3-benzothiadiazole |
| SMILES | C=C(CCCCCCC)Oc1c(OCCCCCCCC)c(Br)c2nsnc2c1C |
| InChI | InChI=1S/C24H37BrN2O2S/c1-5-7-9-11-13-15-17-28-24-20(25)22-21(26-30-27-22)19(4)23(24)29-18(3)16-14-12-10-8-6-2/h3,5-17H2,1-2,4H3 |
| InChIKey | MOTPYJFXJKIXOA-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|