C50H90O7P+ — CID 150757877
2-methylprop-2-enoyl-oxo-(2,3,4,5,6-pentaoctoxyphenyl)phosphanium (PubChem CID 150757877) has the molecular formula C50H90O7P+ and a molecular weight of 834.24 g/mol. Its IUPAC name is 2-methylprop-2-enoyl-oxo-(2,3,4,5,6-pentaoctoxyphenyl)phosphanium.
| Compound Name | 2-methylprop-2-enoyl-oxo-(2,3,4,5,6-pentaoctoxyphenyl)phosphanium |
|---|---|
| PubChem CID | 150757877 |
| Molecular Formula | C50H90O7P+ |
| Molecular Weight | 834.24 g/mol |
| Exact Mass | 833.64 |
| IUPAC Name | 2-methylprop-2-enoyl-oxo-(2,3,4,5,6-pentaoctoxyphenyl)phosphanium |
| SMILES | C=C(C)C(=O)[P+](=O)c1c(OCCCCCCCC)c(OCCCCCCCC)c(OCCCCCCCC)c(OCCCCCCCC)c1OCCCCCCCC |
| InChI | InChI=1S/C50H90O7P/c1-8-13-18-23-28-33-38-53-44-45(54-39-34-29-24-19-14-9-2)47(56-41-36-31-26-21-16-11-4)49(58(52)50(51)43(6)7)48(57-42-37-32-27-22-17-12-5)46(44)55-40-35-30-25-20-15-10-3/h6,8-42H2,1-5,7H3/q+1 |
| InChIKey | YRUWKIDVYZWASE-UHFFFAOYSA-N |
| XLogP | 15.94 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.24 |
| LogP ≤ 5 | 15.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|