C56H74Br2N4O4S5 — CID 122387489
4-(5-bromothiophen-2-yl)-7-[5-[4-(5-bromothiophen-2-yl)-5,6-dioctoxy-2,1,3-benzothiadiazol-7-yl]thiophen-2-yl]-5,6-dioctoxy-2,1,3-benzothiadiazole (PubChem CID 122387489) has the molecular formula C56H74Br2N4O4S5 and a molecular weight of 1187.37 g/mol. Its IUPAC name is 4-(5-bromothiophen-2-yl)-7-[5-[4-(5-bromothiophen-2-yl)-5,6-dioctoxy-2,1,3-benzothiadiazol-7-yl]thiophen-2-yl]-5,6-dioctoxy-2,1,3-benzothiadiazole.
| Compound Name | 4-(5-bromothiophen-2-yl)-7-[5-[4-(5-bromothiophen-2-yl)-5,6-dioctoxy-2,1,3-benzothiadiazol-7-yl]thiophen-2-yl]-5,6-dioctoxy-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 122387489 |
| Molecular Formula | C56H74Br2N4O4S5 |
| Molecular Weight | 1187.37 g/mol |
| Exact Mass | 1184.27 |
| IUPAC Name | 4-(5-bromothiophen-2-yl)-7-[5-[4-(5-bromothiophen-2-yl)-5,6-dioctoxy-2,1,3-benzothiadiazol-7-yl]thiophen-2-yl]-5,6-dioctoxy-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCOc1c(OCCCCCCCC)c(-c2ccc(-c3c(OCCCCCCCC)c(OCCCCCCCC)c(-c4ccc(Br)s4)c4nsnc34)s2)c2nsnc2c1-c1ccc(Br)s1 |
| InChI | InChI=1S/C56H74Br2N4O4S5/c1-5-9-13-17-21-25-35-63-53-45(49-51(61-70-59-49)47(41-31-33-43(57)68-41)55(53)65-37-27-23-19-15-11-7-3)39-29-30-40(67-39)46-50-52(62-71-60-50)48(42-32-34-44(58)69-42)56(66-38-28-24-20-16-12-8-4)54(46)64-36-26-22-18-14-10-6-2/h29-34H,5-28,35-38H2,1-4H3 |
| InChIKey | AJOKEIZKTUSDBN-UHFFFAOYSA-N |
| XLogP | 21.03 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1187.37 |
| LogP ≤ 5 | 21.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|