C33H41Br2F3N2O2S2 — CID 142727103
4,7-bis(5-bromothiophen-2-yl)-2-methyl-5,6-dioctoxy-2-(trifluoromethyl)benzimidazole (PubChem CID 142727103) has the molecular formula C33H41Br2F3N2O2S2 and a molecular weight of 778.64 g/mol. Its IUPAC name is 4,7-bis(5-bromothiophen-2-yl)-2-methyl-5,6-dioctoxy-2-(trifluoromethyl)benzimidazole.
| Compound Name | 4,7-bis(5-bromothiophen-2-yl)-2-methyl-5,6-dioctoxy-2-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 142727103 |
| Molecular Formula | C33H41Br2F3N2O2S2 |
| Molecular Weight | 778.64 g/mol |
| Exact Mass | 776.09 |
| IUPAC Name | 4,7-bis(5-bromothiophen-2-yl)-2-methyl-5,6-dioctoxy-2-(trifluoromethyl)benzimidazole |
| SMILES | CCCCCCCCOc1c(OCCCCCCCC)c(-c2ccc(Br)s2)c2c(c1-c1ccc(Br)s1)=NC(C)(C(F)(F)F)N=2 |
| InChI | InChI=1S/C33H41Br2F3N2O2S2/c1-4-6-8-10-12-14-20-41-30-26(22-16-18-24(34)43-22)28-29(40-32(3,39-28)33(36,37)38)27(23-17-19-25(35)44-23)31(30)42-21-15-13-11-9-7-5-2/h16-19H,4-15,20-21H2,1-3H3 |
| InChIKey | SFYUCJJWXFHQHV-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.64 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|